C12H20N2O — CID 63997154
2-cyano-N-(2,4-dimethylcyclohexyl)propanamide (PubChem CID 63997154) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-cyano-N-(2,4-dimethylcyclohexyl)propanamide.
| Compound Name | 2-cyano-N-(2,4-dimethylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 63997154 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-cyano-N-(2,4-dimethylcyclohexyl)propanamide |
| SMILES | CC1CCC(NC(=O)C(C)C#N)C(C)C1 |
| InChI | InChI=1S/C12H20N2O/c1-8-4-5-11(9(2)6-8)14-12(15)10(3)7-13/h8-11H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | ZFZYJLZLKRFSHP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |