C12H16N2O — CID 103767079
2-cyano-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide (PubChem CID 103767079) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-cyano-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide.
| Compound Name | 2-cyano-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide |
|---|---|
| PubChem CID | 103767079 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-cyano-N-(3-tricyclo[3.2.1.02,4]octanyl)propanamide |
| SMILES | CC(C#N)C(=O)NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C12H16N2O/c1-6(5-13)12(15)14-11-9-7-2-3-8(4-7)10(9)11/h6-11H,2-4H2,1H3,(H,14,15) |
| InChIKey | HJBCHZJZNDHZAK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |