C13H22N2O — CID 103798202
(2S)-2-amino-3-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)butanamide (PubChem CID 103798202) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)butanamide |
|---|---|
| PubChem CID | 103798202 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-(3-tricyclo[3.2.1.02,4]octanyl)butanamide |
| SMILES | CC(C)[C@H](N)C(=O)NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C13H22N2O/c1-6(2)11(14)13(16)15-12-9-7-3-4-8(5-7)10(9)12/h6-12H,3-5,14H2,1-2H3,(H,15,16)/t7?,8?,9?,10?,11-,12?/m0/s1 |
| InChIKey | XYYMZHVXWLKGAA-FMBFNZMWSA-N |
| XLogP | 1.13 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |