About 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide
2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide (PubChem CID 130670272) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide |
| PubChem CID | 130670272 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide |
| SMILES | CC(C#N)C(=O)N[C@@H]1CC[C@H]1O |
| InChI | InChI=1S/C8H12N2O2/c1-5(4-9)8(12)10-6-2-3-7(6)11/h5-7,11H,2-3H2,1H3,(H,10,12)/t5?,6-,7-/m1/s1 |
| InChIKey | CFBBWSIYGWNTCB-JXBXZBNISA-N |
| XLogP | -0.21 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide?
The IUPAC name of 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide (CID 130670272) is 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide.
What is the SMILES notation for 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide?
The canonical SMILES for 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide is CC(C#N)C(=O)N[C@@H]1CC[C@H]1O.
What is the InChIKey of 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide?
The InChIKey is CFBBWSIYGWNTCB-JXBXZBNISA-N. The full InChI is InChI=1S/C8H12N2O2/c1-5(4-9)8(12)10-6-2-3-7(6)11/h5-7,11H,2-3H2,1H3,(H,10,12)/t5?,6-,7-/m1/s1.
What are the key properties of 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide?
2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide has a molecular weight of 168.20 g/mol, XLogP of -0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide is sourced from PubChem (CID 130670272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).