C8H12N2O2 — CID 130670272
2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide (PubChem CID 130670272) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide.
| Compound Name | 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide |
|---|---|
| PubChem CID | 130670272 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | 2-cyano-N-[(1R,2R)-2-hydroxycyclobutyl]propanamide |
| SMILES | CC(C#N)C(=O)N[C@@H]1CC[C@H]1O |
| InChI | InChI=1S/C8H12N2O2/c1-5(4-9)8(12)10-6-2-3-7(6)11/h5-7,11H,2-3H2,1H3,(H,10,12)/t5?,6-,7-/m1/s1 |
| InChIKey | CFBBWSIYGWNTCB-JXBXZBNISA-N |
| XLogP | -0.21 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |