C11H19NO3 — CID 112617292
methyl 2-[(2,4-dimethylcyclohexyl)amino]-2-oxoacetate (PubChem CID 112617292) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is methyl 2-[(2,4-dimethylcyclohexyl)amino]-2-oxoacetate.
| Compound Name | methyl 2-[(2,4-dimethylcyclohexyl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 112617292 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | methyl 2-[(2,4-dimethylcyclohexyl)amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)NC1CCC(C)CC1C |
| InChI | InChI=1S/C11H19NO3/c1-7-4-5-9(8(2)6-7)12-10(13)11(14)15-3/h7-9H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | TUHAEEAOWTWTBA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|