C16H28N2O2S — CID 83036674
1-carbamothioyl-N-(2,2-dimethyloxan-4-yl)cycloheptane-1-carboxamide (PubChem CID 83036674) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 1-carbamothioyl-N-(2,2-dimethyloxan-4-yl)cycloheptane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(2,2-dimethyloxan-4-yl)cycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 83036674 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1-carbamothioyl-N-(2,2-dimethyloxan-4-yl)cycloheptane-1-carboxamide |
| SMILES | CC1(C)CC(NC(=O)C2(C(N)=S)CCCCCC2)CCO1 |
| InChI | InChI=1S/C16H28N2O2S/c1-15(2)11-12(7-10-20-15)18-14(19)16(13(17)21)8-5-3-4-6-9-16/h12H,3-11H2,1-2H3,(H2,17,21)(H,18,19) |
| InChIKey | HGJRNXCCVMJGQN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|