C13H22N2OS2 — CID 114123290
1-carbamothioyl-N-(3-methylsulfanylcyclopentyl)cyclopentane-1-carboxamide (PubChem CID 114123290) has the molecular formula C13H22N2OS2 and a molecular weight of 286.47 g/mol. Its IUPAC name is 1-carbamothioyl-N-(3-methylsulfanylcyclopentyl)cyclopentane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N-(3-methylsulfanylcyclopentyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 114123290 |
| Molecular Formula | C13H22N2OS2 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-carbamothioyl-N-(3-methylsulfanylcyclopentyl)cyclopentane-1-carboxamide |
| SMILES | CSC1CCC(NC(=O)C2(C(N)=S)CCCC2)C1 |
| InChI | InChI=1S/C13H22N2OS2/c1-18-10-5-4-9(8-10)15-12(16)13(11(14)17)6-2-3-7-13/h9-10H,2-8H2,1H3,(H2,14,17)(H,15,16) |
| InChIKey | MXLASQKQIFRYNU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|