C8H17N3OS — CID 83029394
1-amino-3-(2,2-dimethyloxan-4-yl)thiourea (PubChem CID 83029394) has the molecular formula C8H17N3OS and a molecular weight of 203.31 g/mol. Its IUPAC name is 1-amino-3-(2,2-dimethyloxan-4-yl)thiourea.
| Compound Name | 1-amino-3-(2,2-dimethyloxan-4-yl)thiourea |
|---|---|
| PubChem CID | 83029394 |
| Molecular Formula | C8H17N3OS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-amino-3-(2,2-dimethyloxan-4-yl)thiourea |
| SMILES | CC1(C)CC(NC(=S)NN)CCO1 |
| InChI | InChI=1S/C8H17N3OS/c1-8(2)5-6(3-4-12-8)10-7(13)11-9/h6H,3-5,9H2,1-2H3,(H2,10,11,13) |
| InChIKey | DUKXDZMBQYXXHU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|