C17H28N2O5S2 — CID 4617022
1-N-butyl-4-N-(2,2-dimethyloxan-4-yl)benzene-1,4-disulfonamide (PubChem CID 4617022) has the molecular formula C17H28N2O5S2 and a molecular weight of 404.55 g/mol. Its IUPAC name is 1-N-butyl-4-N-(2,2-dimethyloxan-4-yl)benzene-1,4-disulfonamide.
| Compound Name | 1-N-butyl-4-N-(2,2-dimethyloxan-4-yl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 4617022 |
| Molecular Formula | C17H28N2O5S2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-N-butyl-4-N-(2,2-dimethyloxan-4-yl)benzene-1,4-disulfonamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(S(=O)(=O)NC2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C17H28N2O5S2/c1-4-5-11-18-25(20,21)15-6-8-16(9-7-15)26(22,23)19-14-10-12-24-17(2,3)13-14/h6-9,14,18-19H,4-5,10-13H2,1-3H3 |
| InChIKey | BWRVULHYAABXNZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|