C12H19N3O4S2 — CID 119962220
1-N-(3-aminopropyl)-4-N-cyclopropylbenzene-1,4-disulfonamide (PubChem CID 119962220) has the molecular formula C12H19N3O4S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 1-N-(3-aminopropyl)-4-N-cyclopropylbenzene-1,4-disulfonamide.
| Compound Name | 1-N-(3-aminopropyl)-4-N-cyclopropylbenzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 119962220 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 1-N-(3-aminopropyl)-4-N-cyclopropylbenzene-1,4-disulfonamide |
| SMILES | NCCCNS(=O)(=O)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C12H19N3O4S2/c13-8-1-9-14-20(16,17)11-4-6-12(7-5-11)21(18,19)15-10-2-3-10/h4-7,10,14-15H,1-3,8-9,13H2 |
| InChIKey | XXSGCRBQLDHSNM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|