C15H24ClN3O3S — CID 119404968
N-(3-aminopropyl)-3-[4-(cyclopropylsulfamoyl)phenyl]propanamide;hydrochloride (PubChem CID 119404968) has the molecular formula C15H24ClN3O3S and a molecular weight of 361.90 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-[4-(cyclopropylsulfamoyl)phenyl]propanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3-[4-(cyclopropylsulfamoyl)phenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119404968 |
| Molecular Formula | C15H24ClN3O3S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-(3-aminopropyl)-3-[4-(cyclopropylsulfamoyl)phenyl]propanamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)CCc1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C15H23N3O3S.ClH/c16-10-1-11-17-15(19)9-4-12-2-7-14(8-3-12)22(20,21)18-13-5-6-13;/h2-3,7-8,13,18H,1,4-6,9-11,16H2,(H,17,19);1H |
| InChIKey | UBZPVERKHVYYOJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|