C14H23N3O5S2 — CID 120717416
4-N-cyclopropyl-1-N-[2-(2-methoxyethylamino)ethyl]benzene-1,4-disulfonamide (PubChem CID 120717416) has the molecular formula C14H23N3O5S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-N-cyclopropyl-1-N-[2-(2-methoxyethylamino)ethyl]benzene-1,4-disulfonamide.
| Compound Name | 4-N-cyclopropyl-1-N-[2-(2-methoxyethylamino)ethyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 120717416 |
| Molecular Formula | C14H23N3O5S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 4-N-cyclopropyl-1-N-[2-(2-methoxyethylamino)ethyl]benzene-1,4-disulfonamide |
| SMILES | COCCNCCNS(=O)(=O)c1ccc(S(=O)(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C14H23N3O5S2/c1-22-11-10-15-8-9-16-23(18,19)13-4-6-14(7-5-13)24(20,21)17-12-2-3-12/h4-7,12,15-17H,2-3,8-11H2,1H3 |
| InChIKey | SXRYJIOTADDANI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|