C19H30N2O4S — CID 135119424
N-(2,2-dimethyloxan-4-yl)-N-ethyl-4-(propylsulfamoyl)benzamide (PubChem CID 135119424) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-N-ethyl-4-(propylsulfamoyl)benzamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-N-ethyl-4-(propylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 135119424 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-N-ethyl-4-(propylsulfamoyl)benzamide |
| SMILES | CCCNS(=O)(=O)c1ccc(C(=O)N(CC)C2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C19H30N2O4S/c1-5-12-20-26(23,24)17-9-7-15(8-10-17)18(22)21(6-2)16-11-13-25-19(3,4)14-16/h7-10,16,20H,5-6,11-14H2,1-4H3 |
| InChIKey | DUAPARUGEKEMOJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |