C17H26N2O6S2 — CID 648544
N-(2,2-dimethyloxan-4-yl)-4-morpholin-4-ylsulfonylbenzenesulfonamide (PubChem CID 648544) has the molecular formula C17H26N2O6S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-4-morpholin-4-ylsulfonylbenzenesulfonamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-4-morpholin-4-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 648544 |
| Molecular Formula | C17H26N2O6S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-4-morpholin-4-ylsulfonylbenzenesulfonamide |
| SMILES | CC1(C)CC(NS(=O)(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)CCO1 |
| InChI | InChI=1S/C17H26N2O6S2/c1-17(2)13-14(7-10-25-17)18-26(20,21)15-3-5-16(6-4-15)27(22,23)19-8-11-24-12-9-19/h3-6,14,18H,7-13H2,1-2H3 |
| InChIKey | FVGLWZCHWVFUPJ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |