C18H30N2O — CID 115563782
N-[[4-(diethylamino)phenyl]methyl]-2,2-dimethyloxan-4-amine (PubChem CID 115563782) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methyl]-2,2-dimethyloxan-4-amine.
| Compound Name | N-[[4-(diethylamino)phenyl]methyl]-2,2-dimethyloxan-4-amine |
|---|---|
| PubChem CID | 115563782 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methyl]-2,2-dimethyloxan-4-amine |
| SMILES | CCN(CC)c1ccc(CNC2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C18H30N2O/c1-5-20(6-2)17-9-7-15(8-10-17)14-19-16-11-12-21-18(3,4)13-16/h7-10,16,19H,5-6,11-14H2,1-4H3 |
| InChIKey | STIKCTTVYGFWFU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|