C17H27NO2 — CID 115563628
2,2-dimethyl-N-[(4-propoxyphenyl)methyl]oxan-4-amine (PubChem CID 115563628) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(4-propoxyphenyl)methyl]oxan-4-amine.
| Compound Name | 2,2-dimethyl-N-[(4-propoxyphenyl)methyl]oxan-4-amine |
|---|---|
| PubChem CID | 115563628 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 2,2-dimethyl-N-[(4-propoxyphenyl)methyl]oxan-4-amine |
| SMILES | CCCOc1ccc(CNC2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C17H27NO2/c1-4-10-19-16-7-5-14(6-8-16)13-18-15-9-11-20-17(2,3)12-15/h5-8,15,18H,4,9-13H2,1-3H3 |
| InChIKey | CSLJVXBTHOFMNX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |