C13H15N3O2 — CID 18762616
2-(piperidin-4-ylamino)-3,1-benzoxazin-4-one (PubChem CID 18762616) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-(piperidin-4-ylamino)-3,1-benzoxazin-4-one.
| Compound Name | 2-(piperidin-4-ylamino)-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 18762616 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-(piperidin-4-ylamino)-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(NC2CCNCC2)nc2ccccc12 |
| InChI | InChI=1S/C13H15N3O2/c17-12-10-3-1-2-4-11(10)16-13(18-12)15-9-5-7-14-8-6-9/h1-4,9,14H,5-8H2,(H,15,16) |
| InChIKey | MYBXTXQHOCBQCU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |