C21H36N4O — CID 169298705
N'-(2-aminoethyl)-N'-(6-decyl-1,3-benzoxazol-2-yl)ethane-1,2-diamine (PubChem CID 169298705) has the molecular formula C21H36N4O and a molecular weight of 360.55 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N'-(6-decyl-1,3-benzoxazol-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(2-aminoethyl)-N'-(6-decyl-1,3-benzoxazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 169298705 |
| Molecular Formula | C21H36N4O |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | N'-(2-aminoethyl)-N'-(6-decyl-1,3-benzoxazol-2-yl)ethane-1,2-diamine |
| SMILES | CCCCCCCCCCc1ccc2nc(N(CCN)CCN)oc2c1 |
| InChI | InChI=1S/C21H36N4O/c1-2-3-4-5-6-7-8-9-10-18-11-12-19-20(17-18)26-21(24-19)25(15-13-22)16-14-23/h11-12,17H,2-10,13-16,22-23H2,1H3 |
| InChIKey | IPXWWWRCKBQNRO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|