C13H17NO — CID 67428242
5-hexyl-2,1-benzoxazole (PubChem CID 67428242) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 5-hexyl-2,1-benzoxazole.
| Compound Name | 5-hexyl-2,1-benzoxazole |
|---|---|
| PubChem CID | 67428242 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 5-hexyl-2,1-benzoxazole |
| SMILES | CCCCCCc1ccc2nocc2c1 |
| InChI | InChI=1S/C13H17NO/c1-2-3-4-5-6-11-7-8-13-12(9-11)10-15-14-13/h7-10H,2-6H2,1H3 |
| InChIKey | GCTOUMCJSJBQHK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|