C18H27NO — CID 115493598
1-(5-butyl-1-benzofuran-2-yl)-N-propylpropan-1-amine (PubChem CID 115493598) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-(5-butyl-1-benzofuran-2-yl)-N-propylpropan-1-amine.
| Compound Name | 1-(5-butyl-1-benzofuran-2-yl)-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 115493598 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 1-(5-butyl-1-benzofuran-2-yl)-N-propylpropan-1-amine |
| SMILES | CCCCc1ccc2oc(C(CC)NCCC)cc2c1 |
| InChI | InChI=1S/C18H27NO/c1-4-7-8-14-9-10-17-15(12-14)13-18(20-17)16(6-3)19-11-5-2/h9-10,12-13,16,19H,4-8,11H2,1-3H3 |
| InChIKey | JTWHJGBQFAKONV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |