C14H16F3NO — CID 114728050
1-(1-benzofuran-2-yl)-3,3,3-trifluoro-N-propylpropan-1-amine (PubChem CID 114728050) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-3,3,3-trifluoro-N-propylpropan-1-amine.
| Compound Name | 1-(1-benzofuran-2-yl)-3,3,3-trifluoro-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 114728050 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-3,3,3-trifluoro-N-propylpropan-1-amine |
| SMILES | CCCNC(CC(F)(F)F)c1cc2ccccc2o1 |
| InChI | InChI=1S/C14H16F3NO/c1-2-7-18-11(9-14(15,16)17)13-8-10-5-3-4-6-12(10)19-13/h3-6,8,11,18H,2,7,9H2,1H3 |
| InChIKey | ZKPAOYFSYZIPTH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |