C19H27NO — CID 107009087
1-(1-benzofuran-2-yl)-N-propyloct-7-en-1-amine (PubChem CID 107009087) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-N-propyloct-7-en-1-amine.
| Compound Name | 1-(1-benzofuran-2-yl)-N-propyloct-7-en-1-amine |
|---|---|
| PubChem CID | 107009087 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-N-propyloct-7-en-1-amine |
| SMILES | C=CCCCCCC(NCCC)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H27NO/c1-3-5-6-7-8-12-17(20-14-4-2)19-15-16-11-9-10-13-18(16)21-19/h3,9-11,13,15,17,20H,1,4-8,12,14H2,2H3 |
| InChIKey | YRRACNZXELEJQX-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|