C17H26BrN — CID 107008962
1-(2-bromophenyl)-N-propyloct-7-en-1-amine (PubChem CID 107008962) has the molecular formula C17H26BrN and a molecular weight of 324.31 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-propyloct-7-en-1-amine.
| Compound Name | 1-(2-bromophenyl)-N-propyloct-7-en-1-amine |
|---|---|
| PubChem CID | 107008962 |
| Molecular Formula | C17H26BrN |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-(2-bromophenyl)-N-propyloct-7-en-1-amine |
| SMILES | C=CCCCCCC(NCCC)c1ccccc1Br |
| InChI | InChI=1S/C17H26BrN/c1-3-5-6-7-8-13-17(19-14-4-2)15-11-9-10-12-16(15)18/h3,9-12,17,19H,1,4-8,13-14H2,2H3 |
| InChIKey | AZHWWWRFLRIUFF-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|