C16H26N2 — CID 107008851
N-propyl-1-pyridin-2-yloct-7-en-1-amine (PubChem CID 107008851) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-propyl-1-pyridin-2-yloct-7-en-1-amine.
| Compound Name | N-propyl-1-pyridin-2-yloct-7-en-1-amine |
|---|---|
| PubChem CID | 107008851 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-propyl-1-pyridin-2-yloct-7-en-1-amine |
| SMILES | C=CCCCCCC(NCCC)c1ccccn1 |
| InChI | InChI=1S/C16H26N2/c1-3-5-6-7-8-11-15(17-13-4-2)16-12-9-10-14-18-16/h3,9-10,12,14-15,17H,1,4-8,11,13H2,2H3 |
| InChIKey | KJWIJBZATCFZHB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|