C14H22N2 — CID 115890101
(E)-N-(1-pyridin-2-ylbutyl)pent-3-en-1-amine (PubChem CID 115890101) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is (E)-N-(1-pyridin-2-ylbutyl)pent-3-en-1-amine.
| Compound Name | (E)-N-(1-pyridin-2-ylbutyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 115890101 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | (E)-N-(1-pyridin-2-ylbutyl)pent-3-en-1-amine |
| SMILES | C/C=C/CCNC(CCC)c1ccccn1 |
| InChI | InChI=1S/C14H22N2/c1-3-5-7-11-15-13(9-4-2)14-10-6-8-12-16-14/h3,5-6,8,10,12-13,15H,4,7,9,11H2,1-2H3/b5-3+ |
| InChIKey | AHKJQUSFGUDVPJ-HWKANZROSA-N |
| XLogP | 3.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|