C12H20N2O — CID 103878434
(2R)-2-(1-pyridin-2-ylbutylamino)propan-1-ol (PubChem CID 103878434) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is (2R)-2-(1-pyridin-2-ylbutylamino)propan-1-ol.
| Compound Name | (2R)-2-(1-pyridin-2-ylbutylamino)propan-1-ol |
|---|---|
| PubChem CID | 103878434 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | (2R)-2-(1-pyridin-2-ylbutylamino)propan-1-ol |
| SMILES | CCCC(N[C@H](C)CO)c1ccccn1 |
| InChI | InChI=1S/C12H20N2O/c1-3-6-12(14-10(2)9-15)11-7-4-5-8-13-11/h4-5,7-8,10,12,14-15H,3,6,9H2,1-2H3/t10-,12?/m1/s1 |
| InChIKey | XXYVYMRCZDZAGI-RWANSRKNSA-N |
| XLogP | 1.89 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |