C17H22ClNO — CID 25187211
5-chloro-2-dec-9-enyl-1,3-benzoxazole (PubChem CID 25187211) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is 5-chloro-2-dec-9-enyl-1,3-benzoxazole.
| Compound Name | 5-chloro-2-dec-9-enyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 25187211 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 5-chloro-2-dec-9-enyl-1,3-benzoxazole |
| SMILES | C=CCCCCCCCCc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C17H22ClNO/c1-2-3-4-5-6-7-8-9-10-17-19-15-13-14(18)11-12-16(15)20-17/h2,11-13H,1,3-10H2 |
| InChIKey | DWTYMHNXOXBELT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|