C13H13N3O3S2 — CID 175087915
N'-[2-(1,3-benzoxazol-2-yl)ethyl]thiophene-2-sulfonohydrazide (PubChem CID 175087915) has the molecular formula C13H13N3O3S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N'-[2-(1,3-benzoxazol-2-yl)ethyl]thiophene-2-sulfonohydrazide.
| Compound Name | N'-[2-(1,3-benzoxazol-2-yl)ethyl]thiophene-2-sulfonohydrazide |
|---|---|
| PubChem CID | 175087915 |
| Molecular Formula | C13H13N3O3S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | N'-[2-(1,3-benzoxazol-2-yl)ethyl]thiophene-2-sulfonohydrazide |
| SMILES | O=S(=O)(NNCCc1nc2ccccc2o1)c1cccs1 |
| InChI | InChI=1S/C13H13N3O3S2/c17-21(18,13-6-3-9-20-13)16-14-8-7-12-15-10-4-1-2-5-11(10)19-12/h1-6,9,14,16H,7-8H2 |
| InChIKey | ZOEGXWXEGRXZBW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|