C14H19N3O3S — CID 125419022
N-[2-(1,3-benzoxazol-2-yl)ethyl]piperidine-1-sulfonamide (PubChem CID 125419022) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[2-(1,3-benzoxazol-2-yl)ethyl]piperidine-1-sulfonamide.
| Compound Name | N-[2-(1,3-benzoxazol-2-yl)ethyl]piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 125419022 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[2-(1,3-benzoxazol-2-yl)ethyl]piperidine-1-sulfonamide |
| SMILES | O=S(=O)(NCCc1nc2ccccc2o1)N1CCCCC1 |
| InChI | InChI=1S/C14H19N3O3S/c18-21(19,17-10-4-1-5-11-17)15-9-8-14-16-12-6-2-3-7-13(12)20-14/h2-3,6-7,15H,1,4-5,8-11H2 |
| InChIKey | OKJTULBRFSIWAU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |