C13H12N2O2S3 — CID 9190738
N-[2-(1,3-benzothiazol-2-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 9190738) has the molecular formula C13H12N2O2S3 and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 9190738 |
| Molecular Formula | C13H12N2O2S3 |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCc1nc2ccccc2s1)c1cccs1 |
| InChI | InChI=1S/C13H12N2O2S3/c16-20(17,13-6-3-9-18-13)14-8-7-12-15-10-4-1-2-5-11(10)19-12/h1-6,9,14H,7-8H2 |
| InChIKey | CVAKFBVHJXRQSL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |