C18H20N2O2S2 — CID 78809854
N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-propan-2-ylbenzenesulfonamide (PubChem CID 78809854) has the molecular formula C18H20N2O2S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-propan-2-ylbenzenesulfonamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 78809854 |
| Molecular Formula | C18H20N2O2S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-4-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)NCCc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C18H20N2O2S2/c1-13(2)14-7-9-15(10-8-14)24(21,22)19-12-11-18-20-16-5-3-4-6-17(16)23-18/h3-10,13,19H,11-12H2,1-2H3 |
| InChIKey | UGIMQNMVAPRFMK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |