C25H31N3O3S2 — CID 38901679
N-[3-(1,3-benzothiazol-2-yl)propyl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 38901679) has the molecular formula C25H31N3O3S2 and a molecular weight of 485.68 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 38901679 |
| Molecular Formula | C25H31N3O3S2 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-1-(4-propan-2-ylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCC(C(=O)NCCCc3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C25H31N3O3S2/c1-18(2)19-9-11-21(12-10-19)33(30,31)28-16-13-20(14-17-28)25(29)26-15-5-8-24-27-22-6-3-4-7-23(22)32-24/h3-4,6-7,9-12,18,20H,5,8,13-17H2,1-2H3,(H,26,29) |
| InChIKey | RYVKKXCAZJWMMJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|