C17H17IN2S — CID 43768180
N-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(4-iodophenyl)ethanamine (PubChem CID 43768180) has the molecular formula C17H17IN2S and a molecular weight of 408.31 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(4-iodophenyl)ethanamine.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(4-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 43768180 |
| Molecular Formula | C17H17IN2S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)ethyl]-1-(4-iodophenyl)ethanamine |
| SMILES | CC(NCCc1nc2ccccc2s1)c1ccc(I)cc1 |
| InChI | InChI=1S/C17H17IN2S/c1-12(13-6-8-14(18)9-7-13)19-11-10-17-20-15-4-2-3-5-16(15)21-17/h2-9,12,19H,10-11H2,1H3 |
| InChIKey | OHFIXWUBBXUJBS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|