C21H24N2O3 — CID 100510330
N-[2-(3,4-dimethylphenoxy)ethyl]-3-(5-methyl-1,3-benzoxazol-2-yl)propanamide (PubChem CID 100510330) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenoxy)ethyl]-3-(5-methyl-1,3-benzoxazol-2-yl)propanamide.
| Compound Name | N-[2-(3,4-dimethylphenoxy)ethyl]-3-(5-methyl-1,3-benzoxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 100510330 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[2-(3,4-dimethylphenoxy)ethyl]-3-(5-methyl-1,3-benzoxazol-2-yl)propanamide |
| SMILES | Cc1ccc2oc(CCC(=O)NCCOc3ccc(C)c(C)c3)nc2c1 |
| InChI | InChI=1S/C21H24N2O3/c1-14-4-7-19-18(12-14)23-21(26-19)9-8-20(24)22-10-11-25-17-6-5-15(2)16(3)13-17/h4-7,12-13H,8-11H2,1-3H3,(H,22,24) |
| InChIKey | RXILAADTLIBZLZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|