C17H21N3O2 — CID 138049489
3-(3,4-dimethylphenoxy)-N-(2-pyrimidin-2-ylethyl)propanamide (PubChem CID 138049489) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3-(3,4-dimethylphenoxy)-N-(2-pyrimidin-2-ylethyl)propanamide.
| Compound Name | 3-(3,4-dimethylphenoxy)-N-(2-pyrimidin-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 138049489 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 3-(3,4-dimethylphenoxy)-N-(2-pyrimidin-2-ylethyl)propanamide |
| SMILES | Cc1ccc(OCCC(=O)NCCc2ncccn2)cc1C |
| InChI | InChI=1S/C17H21N3O2/c1-13-4-5-15(12-14(13)2)22-11-7-17(21)20-10-6-16-18-8-3-9-19-16/h3-5,8-9,12H,6-7,10-11H2,1-2H3,(H,20,21) |
| InChIKey | GHLBTQUEHMVGED-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |