C23H25N3O3 — CID 55904813
N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanamide (PubChem CID 55904813) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanamide.
| Compound Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 55904813 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]propanamide |
| SMILES | Cc1ccc(-c2nnc(CCC(=O)NCCOc3ccc4c(c3)CCC4)o2)cc1 |
| InChI | InChI=1S/C23H25N3O3/c1-16-5-7-18(8-6-16)23-26-25-22(29-23)12-11-21(27)24-13-14-28-20-10-9-17-3-2-4-19(17)15-20/h5-10,15H,2-4,11-14H2,1H3,(H,24,27) |
| InChIKey | YRVJAFJLLUEPHX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|