C10H10N2OS2 — CID 71371041
methyl N-(1,3-benzoxazol-2-ylmethyl)carbamodithioate (PubChem CID 71371041) has the molecular formula C10H10N2OS2 and a molecular weight of 238.34 g/mol. Its IUPAC name is methyl N-(1,3-benzoxazol-2-ylmethyl)carbamodithioate.
| Compound Name | methyl N-(1,3-benzoxazol-2-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 71371041 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | methyl N-(1,3-benzoxazol-2-ylmethyl)carbamodithioate |
| SMILES | CSC(=S)NCc1nc2ccccc2o1 |
| InChI | InChI=1S/C10H10N2OS2/c1-15-10(14)11-6-9-12-7-4-2-3-5-8(7)13-9/h2-5H,6H2,1H3,(H,11,14) |
| InChIKey | AHABQRBDIMXOEB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|