C24H14N4O5 — CID 175430641
4-hydroxy-3-[7-(4-nitrophenyl)-1,2-dihydropyrrolo[2,3-g]indazol-8-yl]chromen-2-one (PubChem CID 175430641) has the molecular formula C24H14N4O5 and a molecular weight of 438.40 g/mol. Its IUPAC name is 4-hydroxy-3-[7-(4-nitrophenyl)-1,2-dihydropyrrolo[2,3-g]indazol-8-yl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[7-(4-nitrophenyl)-1,2-dihydropyrrolo[2,3-g]indazol-8-yl]chromen-2-one |
|---|---|
| PubChem CID | 175430641 |
| Molecular Formula | C24H14N4O5 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 4-hydroxy-3-[7-(4-nitrophenyl)-1,2-dihydropyrrolo[2,3-g]indazol-8-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1-c1c(-c2ccc([N+](=O)[O-])cc2)nc2ccc3c[nH][nH]c3c12 |
| InChI | InChI=1S/C24H14N4O5/c29-23-15-3-1-2-4-17(15)33-24(30)20(23)19-18-16(10-7-13-11-25-27-22(13)18)26-21(19)12-5-8-14(9-6-12)28(31)32/h1-11,25,27,29H |
| InChIKey | OQAYSQWAEHKIKF-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|