C29H16N2O6 — CID 56945224
3-(2-hydroxybenzoyl)-5-(4-nitrophenyl)chromeno[2,3-c]isoquinolin-12-one (PubChem CID 56945224) has the molecular formula C29H16N2O6 and a molecular weight of 488.46 g/mol. Its IUPAC name is 3-(2-hydroxybenzoyl)-5-(4-nitrophenyl)chromeno[2,3-c]isoquinolin-12-one.
| Compound Name | 3-(2-hydroxybenzoyl)-5-(4-nitrophenyl)chromeno[2,3-c]isoquinolin-12-one |
|---|---|
| PubChem CID | 56945224 |
| Molecular Formula | C29H16N2O6 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 3-(2-hydroxybenzoyl)-5-(4-nitrophenyl)chromeno[2,3-c]isoquinolin-12-one |
| SMILES | O=C(c1ccc2c(c1)c(-c1ccc([N+](=O)[O-])cc1)nc1oc3ccccc3c(=O)c12)c1ccccc1O |
| InChI | InChI=1S/C29H16N2O6/c32-23-7-3-1-5-20(23)27(33)17-11-14-19-22(15-17)26(16-9-12-18(13-10-16)31(35)36)30-29-25(19)28(34)21-6-2-4-8-24(21)37-29/h1-15,32H |
| InChIKey | FKIUPSGAJAHSJU-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 123.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|