C34H24N4O5 — CID 139216314
4-hydroxy-3-[4-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-4,5-dihydro-3H-1-benzazepin-2-yl]chromen-2-one (PubChem CID 139216314) has the molecular formula C34H24N4O5 and a molecular weight of 568.59 g/mol. Its IUPAC name is 4-hydroxy-3-[4-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-4,5-dihydro-3H-1-benzazepin-2-yl]chromen-2-one.
| Compound Name | 4-hydroxy-3-[4-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-4,5-dihydro-3H-1-benzazepin-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 139216314 |
| Molecular Formula | C34H24N4O5 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.17 |
| IUPAC Name | 4-hydroxy-3-[4-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-4,5-dihydro-3H-1-benzazepin-2-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C1=Nc2ccccc2CC(c2cn(-c3ccccc3)nc2-c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C34H24N4O5/c39-33-26-11-5-7-13-30(26)43-34(40)31(33)29-19-23(18-22-8-4-6-12-28(22)35-29)27-20-37(24-9-2-1-3-10-24)36-32(27)21-14-16-25(17-15-21)38(41)42/h1-17,20,23,39H,18-19H2 |
| InChIKey | ZITRBYUMEAAYBG-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|