C23H17N3O3 — CID 135936900
4-hydroxy-3-(2-phenyl-3-pyridin-3-yl-3,4-dihydropyrazol-5-yl)chromen-2-one (PubChem CID 135936900) has the molecular formula C23H17N3O3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 4-hydroxy-3-(2-phenyl-3-pyridin-3-yl-3,4-dihydropyrazol-5-yl)chromen-2-one.
| Compound Name | 4-hydroxy-3-(2-phenyl-3-pyridin-3-yl-3,4-dihydropyrazol-5-yl)chromen-2-one |
|---|---|
| PubChem CID | 135936900 |
| Molecular Formula | C23H17N3O3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 4-hydroxy-3-(2-phenyl-3-pyridin-3-yl-3,4-dihydropyrazol-5-yl)chromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1C1=NN(c2ccccc2)C(c2cccnc2)C1 |
| InChI | InChI=1S/C23H17N3O3/c27-22-17-10-4-5-11-20(17)29-23(28)21(22)18-13-19(15-7-6-12-24-14-15)26(25-18)16-8-2-1-3-9-16/h1-12,14,19,27H,13H2 |
| InChIKey | SAGYZRUXMAOEQJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 78.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|