C31H21N5O3 — CID 139218406
2-amino-6-(4-hydroxy-2-oxochromen-3-yl)-4-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]pyridine-3-carbonitrile (PubChem CID 139218406) has the molecular formula C31H21N5O3 and a molecular weight of 511.54 g/mol. Its IUPAC name is 2-amino-6-(4-hydroxy-2-oxochromen-3-yl)-4-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-hydroxy-2-oxochromen-3-yl)-4-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 139218406 |
| Molecular Formula | C31H21N5O3 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 2-amino-6-(4-hydroxy-2-oxochromen-3-yl)-4-[3-(4-methylphenyl)-1-phenylpyrazol-4-yl]pyridine-3-carbonitrile |
| SMILES | Cc1ccc(-c2nn(-c3ccccc3)cc2-c2cc(-c3c(O)c4ccccc4oc3=O)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C31H21N5O3/c1-18-11-13-19(14-12-18)28-24(17-36(35-28)20-7-3-2-4-8-20)22-15-25(34-30(33)23(22)16-32)27-29(37)21-9-5-6-10-26(21)39-31(27)38/h2-15,17,37H,1H3,(H2,33,34) |
| InChIKey | WFTKBOZEKKHNDJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 130.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|