C34H21Cl2N3O3 — CID 135916098
2-(5-chloro-2-hydroxyphenyl)-4-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-8-methylchromeno[4,3-b]pyridin-5-one (PubChem CID 135916098) has the molecular formula C34H21Cl2N3O3 and a molecular weight of 590.47 g/mol. Its IUPAC name is 2-(5-chloro-2-hydroxyphenyl)-4-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-8-methylchromeno[4,3-b]pyridin-5-one.
| Compound Name | 2-(5-chloro-2-hydroxyphenyl)-4-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-8-methylchromeno[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 135916098 |
| Molecular Formula | C34H21Cl2N3O3 |
| Molecular Weight | 590.47 g/mol |
| Exact Mass | 589.10 |
| IUPAC Name | 2-(5-chloro-2-hydroxyphenyl)-4-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-8-methylchromeno[4,3-b]pyridin-5-one |
| SMILES | Cc1ccc2c(c1)oc(=O)c1c(-c3cn(-c4ccccc4)nc3-c3ccc(Cl)cc3)cc(-c3cc(Cl)ccc3O)nc12 |
| InChI | InChI=1S/C34H21Cl2N3O3/c1-19-7-13-24-30(15-19)42-34(41)31-25(17-28(37-33(24)31)26-16-22(36)12-14-29(26)40)27-18-39(23-5-3-2-4-6-23)38-32(27)20-8-10-21(35)11-9-20/h2-18,40H,1H3 |
| InChIKey | OZLDEESZVBQHSW-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.47 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|