C35H22Cl2IN3O3 — CID 171353994
2-(2,3-dichloro-6-hydroxy-5-iodo-4-methylphenyl)-4-(1,3-diphenylpyrazol-4-yl)-8-methylchromeno[4,3-b]pyridin-5-one (PubChem CID 171353994) has the molecular formula C35H22Cl2IN3O3 and a molecular weight of 730.39 g/mol. Its IUPAC name is 2-(2,3-dichloro-6-hydroxy-5-iodo-4-methylphenyl)-4-(1,3-diphenylpyrazol-4-yl)-8-methylchromeno[4,3-b]pyridin-5-one.
| Compound Name | 2-(2,3-dichloro-6-hydroxy-5-iodo-4-methylphenyl)-4-(1,3-diphenylpyrazol-4-yl)-8-methylchromeno[4,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 171353994 |
| Molecular Formula | C35H22Cl2IN3O3 |
| Molecular Weight | 730.39 g/mol |
| Exact Mass | 729.01 |
| IUPAC Name | 2-(2,3-dichloro-6-hydroxy-5-iodo-4-methylphenyl)-4-(1,3-diphenylpyrazol-4-yl)-8-methylchromeno[4,3-b]pyridin-5-one |
| SMILES | Cc1ccc2c(c1)oc(=O)c1c(-c3cn(-c4ccccc4)nc3-c3ccccc3)cc(-c3c(O)c(I)c(C)c(Cl)c3Cl)nc12 |
| InChI | InChI=1S/C35H22Cl2IN3O3/c1-18-13-14-22-26(15-18)44-35(43)27-23(16-25(39-33(22)27)28-30(37)29(36)19(2)31(38)34(28)42)24-17-41(21-11-7-4-8-12-21)40-32(24)20-9-5-3-6-10-20/h3-17,42H,1-2H3 |
| InChIKey | QPGGNBDJLCRYDG-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.39 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|