C18H14N4O3 — CID 71687887
2-(1,3-diphenylpyrazol-4-yl)-5-methyl-3,4-dioxido-1,3,4-oxadiazole-3,4-diium (PubChem CID 71687887) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-(1,3-diphenylpyrazol-4-yl)-5-methyl-3,4-dioxido-1,3,4-oxadiazole-3,4-diium.
| Compound Name | 2-(1,3-diphenylpyrazol-4-yl)-5-methyl-3,4-dioxido-1,3,4-oxadiazole-3,4-diium |
|---|---|
| PubChem CID | 71687887 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(1,3-diphenylpyrazol-4-yl)-5-methyl-3,4-dioxido-1,3,4-oxadiazole-3,4-diium |
| SMILES | Cc1oc(-c2cn(-c3ccccc3)nc2-c2ccccc2)[n+]([O-])[n+]1[O-] |
| InChI | InChI=1S/C18H14N4O3/c1-13-21(23)22(24)18(25-13)16-12-20(15-10-6-3-7-11-15)19-17(16)14-8-4-2-5-9-14/h2-12H,1H3 |
| InChIKey | FEXWCKMUDZTDJA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|