C27H18N4O3 — CID 155923430
3-(1,3-diphenylpyrazol-4-yl)-1,2-dihydrochromeno[4,3-c]diazepine-5,6-dione (PubChem CID 155923430) has the molecular formula C27H18N4O3 and a molecular weight of 446.47 g/mol. Its IUPAC name is 3-(1,3-diphenylpyrazol-4-yl)-1,2-dihydrochromeno[4,3-c]diazepine-5,6-dione.
| Compound Name | 3-(1,3-diphenylpyrazol-4-yl)-1,2-dihydrochromeno[4,3-c]diazepine-5,6-dione |
|---|---|
| PubChem CID | 155923430 |
| Molecular Formula | C27H18N4O3 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-(1,3-diphenylpyrazol-4-yl)-1,2-dihydrochromeno[4,3-c]diazepine-5,6-dione |
| SMILES | O=C1C=C(c2cn(-c3ccccc3)nc2-c2ccccc2)NNc2c1c(=O)oc1ccccc21 |
| InChI | InChI=1S/C27H18N4O3/c32-22-15-21(28-29-26-19-13-7-8-14-23(19)34-27(33)24(22)26)20-16-31(18-11-5-2-6-12-18)30-25(20)17-9-3-1-4-10-17/h1-16,28-29H |
| InChIKey | UEOWJYSLBCZCHY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|