C22H16N4O3 — CID 163129742
4-[4-(1,3-benzoxazol-2-yl)-1-phenylpyrazol-3-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163129742) has the molecular formula C22H16N4O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is 4-[4-(1,3-benzoxazol-2-yl)-1-phenylpyrazol-3-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[4-(1,3-benzoxazol-2-yl)-1-phenylpyrazol-3-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163129742 |
| Molecular Formula | C22H16N4O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 4-[4-(1,3-benzoxazol-2-yl)-1-phenylpyrazol-3-yl]-N-hydroxybenzeneamine oxide |
| SMILES | [O-][NH+](O)c1ccc(-c2nn(-c3ccccc3)cc2-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C22H16N4O3/c27-26(28)17-12-10-15(11-13-17)21-18(14-25(24-21)16-6-2-1-3-7-16)22-23-19-8-4-5-9-20(19)29-22/h1-14,26-27H |
| InChIKey | FRIZLQMCFUDVMD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|