C24H18N6O4 — CID 6976236
1-[(2R)-2-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-5-pyridin-4-yl-2H-1,3,4-oxadiazol-3-yl]ethanone (PubChem CID 6976236) has the molecular formula C24H18N6O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 1-[(2R)-2-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-5-pyridin-4-yl-2H-1,3,4-oxadiazol-3-yl]ethanone.
| Compound Name | 1-[(2R)-2-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-5-pyridin-4-yl-2H-1,3,4-oxadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 6976236 |
| Molecular Formula | C24H18N6O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 1-[(2R)-2-[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]-5-pyridin-4-yl-2H-1,3,4-oxadiazol-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2ccncc2)O[C@@H]1c1cn(-c2ccccc2)nc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H18N6O4/c1-16(31)29-24(34-23(27-29)18-11-13-25-14-12-18)21-15-28(19-5-3-2-4-6-19)26-22(21)17-7-9-20(10-8-17)30(32)33/h2-15,24H,1H3/t24-/m1/s1 |
| InChIKey | JMWKVYXLYOFBSX-XMMPIXPASA-N |
| XLogP | 4.08 |
| TPSA | 115.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|