C25H17N3O4S — CID 170838449
5-(4-methylphenyl)imino-2-(4-nitrophenyl)-1H-chromeno[4,3-e][1,4]thiazepin-6-one (PubChem CID 170838449) has the molecular formula C25H17N3O4S and a molecular weight of 455.50 g/mol. Its IUPAC name is 5-(4-methylphenyl)imino-2-(4-nitrophenyl)-1H-chromeno[4,3-e][1,4]thiazepin-6-one.
| Compound Name | 5-(4-methylphenyl)imino-2-(4-nitrophenyl)-1H-chromeno[4,3-e][1,4]thiazepin-6-one |
|---|---|
| PubChem CID | 170838449 |
| Molecular Formula | C25H17N3O4S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | 5-(4-methylphenyl)imino-2-(4-nitrophenyl)-1H-chromeno[4,3-e][1,4]thiazepin-6-one |
| SMILES | Cc1ccc(/N=C2\SC=C(c3ccc([N+](=O)[O-])cc3)Nc3c2c(=O)oc2ccccc32)cc1 |
| InChI | InChI=1S/C25H17N3O4S/c1-15-6-10-17(11-7-15)26-24-22-23(19-4-2-3-5-21(19)32-25(22)29)27-20(14-33-24)16-8-12-18(13-9-16)28(30)31/h2-14,27H,1H3/b26-24- |
| InChIKey | ZKZPFTGQCDSGAD-LCUIJRPUSA-N |
| XLogP | 6.25 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|