C21H17NO5 — CID 44541529
2-butyl-3-(4-nitrophenyl)furo[3,2-c]chromen-4-one (PubChem CID 44541529) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-butyl-3-(4-nitrophenyl)furo[3,2-c]chromen-4-one.
| Compound Name | 2-butyl-3-(4-nitrophenyl)furo[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 44541529 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-butyl-3-(4-nitrophenyl)furo[3,2-c]chromen-4-one |
| SMILES | CCCCc1oc2c(c1-c1ccc([N+](=O)[O-])cc1)c(=O)oc1ccccc12 |
| InChI | InChI=1S/C21H17NO5/c1-2-3-7-17-18(13-9-11-14(12-10-13)22(24)25)19-20(26-17)15-6-4-5-8-16(15)27-21(19)23/h4-6,8-12H,2-3,7H2,1H3 |
| InChIKey | MYHSJJKIOGOSRZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 86.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|